C23H35N3O5 — CID 143939286
2-[4-(dimethylamino)phenyl]-2-methoxy-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide;ethane;molecular hydrogen (PubChem CID 143939286) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-2-methoxy-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide;ethane;molecular hydrogen.
| Compound Name | 2-[4-(dimethylamino)phenyl]-2-methoxy-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 143939286 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-2-methoxy-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide;ethane;molecular hydrogen |
| SMILES | CC.COc1cc(/C=N/NC(=O)C(OC)c2ccc(N(C)C)cc2)cc(OC)c1OC.[H][H] |
| InChI | InChI=1S/C21H27N3O5.C2H6.H2/c1-24(2)16-9-7-15(8-10-16)19(28-5)21(25)23-22-13-14-11-17(26-3)20(29-6)18(12-14)27-4;1-2;/h7-13,19H,1-6H3,(H,23,25);1-2H3;1H/b22-13+;; |
| InChIKey | PPQSIPRSYAHINI-AFOQGCOTSA-N |
| XLogP | 3.89 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|