C21H26BrN3O4 — CID 59185959
N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-[4-(dimethylamino)phenyl]-2-ethoxyacetamide (PubChem CID 59185959) has the molecular formula C21H26BrN3O4 and a molecular weight of 464.36 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-[4-(dimethylamino)phenyl]-2-ethoxyacetamide.
| Compound Name | N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-[4-(dimethylamino)phenyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 59185959 |
| Molecular Formula | C21H26BrN3O4 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | N-[(E)-(3-bromo-4,5-dimethoxyphenyl)methylideneamino]-2-[4-(dimethylamino)phenyl]-2-ethoxyacetamide |
| SMILES | CCOC(C(=O)N/N=C/c1cc(Br)c(OC)c(OC)c1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H26BrN3O4/c1-6-29-19(15-7-9-16(10-8-15)25(2)3)21(26)24-23-13-14-11-17(22)20(28-5)18(12-14)27-4/h7-13,19H,6H2,1-5H3,(H,24,26)/b23-13+ |
| InChIKey | QNTMOMJUSIMOIW-YDZHTSKRSA-N |
| XLogP | 3.76 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|