C22H26ClN3O5 — CID 72537591
N-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-ethoxy-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide (PubChem CID 72537591) has the molecular formula C22H26ClN3O5 and a molecular weight of 447.92 g/mol. Its IUPAC name is N-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-ethoxy-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide.
| Compound Name | N-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-ethoxy-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide |
|---|---|
| PubChem CID | 72537591 |
| Molecular Formula | C22H26ClN3O5 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-ethoxy-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide |
| SMILES | CCOC(C(=O)NN=Cc1cc(Cl)c(OC)c(OC)c1)c1ccc2c(c1)OCCN2C |
| InChI | InChI=1S/C22H26ClN3O5/c1-5-30-20(15-6-7-17-18(12-15)31-9-8-26(17)2)22(27)25-24-13-14-10-16(23)21(29-4)19(11-14)28-3/h6-7,10-13,20H,5,8-9H2,1-4H3,(H,25,27) |
| InChIKey | ACLGOCXACHRSBL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|