C22H26N2O6 — CID 72537518
2-(2,3-dihydro-1,4-benzodioxin-5-yl)-N-[(3,5-dimethoxy-4-methylphenyl)methylideneamino]-2-ethoxyacetamide (PubChem CID 72537518) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-5-yl)-N-[(3,5-dimethoxy-4-methylphenyl)methylideneamino]-2-ethoxyacetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-5-yl)-N-[(3,5-dimethoxy-4-methylphenyl)methylideneamino]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 72537518 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-5-yl)-N-[(3,5-dimethoxy-4-methylphenyl)methylideneamino]-2-ethoxyacetamide |
| SMILES | CCOC(C(=O)NN=Cc1cc(OC)c(C)c(OC)c1)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C22H26N2O6/c1-5-28-21(16-7-6-8-17-20(16)30-10-9-29-17)22(25)24-23-13-15-11-18(26-3)14(2)19(12-15)27-4/h6-8,11-13,21H,5,9-10H2,1-4H3,(H,24,25) |
| InChIKey | USHFPZDJWKDKAL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|