C38H45IN4O8 — CID 172939095
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-N-methyl-2-phenylacetamide;N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-2-phenylacetamide;iodomethane (PubChem CID 172939095) has the molecular formula C38H45IN4O8 and a molecular weight of 812.70 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-N-methyl-2-phenylacetamide;N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-2-phenylacetamide;iodomethane.
| Compound Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-N-methyl-2-phenylacetamide;N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-2-phenylacetamide;iodomethane |
|---|---|
| PubChem CID | 172939095 |
| Molecular Formula | C38H45IN4O8 |
| Molecular Weight | 812.70 g/mol |
| Exact Mass | 812.23 |
| IUPAC Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-N-methyl-2-phenylacetamide;N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-2-phenylacetamide;iodomethane |
| SMILES | CI.COc1ccc(/C=N/N(C)C(=O)C(OC)c2ccccc2)cc1OC.COc1ccc(/C=N/NC(=O)C(OC)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H22N2O4.C18H20N2O4.CH3I/c1-21(19(22)18(25-4)15-8-6-5-7-9-15)20-13-14-10-11-16(23-2)17(12-14)24-3;1-22-15-10-9-13(11-16(15)23-2)12-19-20-18(21)17(24-3)14-7-5-4-6-8-14;1-2/h5-13,18H,1-4H3;4-12,17H,1-3H3,(H,20,21);1H3/b20-13+;19-12+; |
| InChIKey | AXCHKADAPCDUEO-RQKJLNIFSA-N |
| XLogP | 6.48 |
| TPSA | 129.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.70 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|