C39H46IN3O8 — CID 172947796
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-N-methyl-2-phenylacetamide;3-[(3,4-dimethoxyphenyl)methylideneamino]-1-methoxy-1-phenylpropan-2-one;iodomethane (PubChem CID 172947796) has the molecular formula C39H46IN3O8 and a molecular weight of 811.71 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-N-methyl-2-phenylacetamide;3-[(3,4-dimethoxyphenyl)methylideneamino]-1-methoxy-1-phenylpropan-2-one;iodomethane.
| Compound Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-N-methyl-2-phenylacetamide;3-[(3,4-dimethoxyphenyl)methylideneamino]-1-methoxy-1-phenylpropan-2-one;iodomethane |
|---|---|
| PubChem CID | 172947796 |
| Molecular Formula | C39H46IN3O8 |
| Molecular Weight | 811.71 g/mol |
| Exact Mass | 811.23 |
| IUPAC Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-2-methoxy-N-methyl-2-phenylacetamide;3-[(3,4-dimethoxyphenyl)methylideneamino]-1-methoxy-1-phenylpropan-2-one;iodomethane |
| SMILES | CI.COc1ccc(/C=N/CC(=O)C(OC)c2ccccc2)cc1OC.COc1ccc(/C=N/N(C)C(=O)C(OC)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H22N2O4.C19H21NO4.CH3I/c1-21(19(22)18(25-4)15-8-6-5-7-9-15)20-13-14-10-11-16(23-2)17(12-14)24-3;1-22-17-10-9-14(11-18(17)23-2)12-20-13-16(21)19(24-3)15-7-5-4-6-8-15;1-2/h5-13,18H,1-4H3;4-12,19H,13H2,1-3H3;1H3/b20-13+;20-12+; |
| InChIKey | IHTVMHIDNKWVGS-BGEXOQRRSA-N |
| XLogP | 7.01 |
| TPSA | 117.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.71 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|