C23H27ClN2O4 — CID 159848895
3-[(4-chloro-3,5-dimethoxyphenyl)methylideneamino]-1-methoxy-1-(4-pyrrolidin-1-ylphenyl)propan-2-one (PubChem CID 159848895) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is 3-[(4-chloro-3,5-dimethoxyphenyl)methylideneamino]-1-methoxy-1-(4-pyrrolidin-1-ylphenyl)propan-2-one.
| Compound Name | 3-[(4-chloro-3,5-dimethoxyphenyl)methylideneamino]-1-methoxy-1-(4-pyrrolidin-1-ylphenyl)propan-2-one |
|---|---|
| PubChem CID | 159848895 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-[(4-chloro-3,5-dimethoxyphenyl)methylideneamino]-1-methoxy-1-(4-pyrrolidin-1-ylphenyl)propan-2-one |
| SMILES | COc1cc(/C=N/CC(=O)C(OC)c2ccc(N3CCCC3)cc2)cc(OC)c1Cl |
| InChI | InChI=1S/C23H27ClN2O4/c1-28-20-12-16(13-21(29-2)22(20)24)14-25-15-19(27)23(30-3)17-6-8-18(9-7-17)26-10-4-5-11-26/h6-9,12-14,23H,4-5,10-11,15H2,1-3H3/b25-14+ |
| InChIKey | NPRBYVNPOOJYHQ-AFUMVMLFSA-N |
| XLogP | 4.33 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|