C29H38N2O3 — CID 147833224
2-[2-[(1S,2S)-2-methylcyclopropyl]phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 147833224) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is 2-[2-[(1S,2S)-2-methylcyclopropyl]phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[2-[(1S,2S)-2-methylcyclopropyl]phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 147833224 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 2-[2-[(1S,2S)-2-methylcyclopropyl]phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | C[C@H]1C[C@@H]1c1ccccc1C(C(=O)O)N1CC[C@@H](OCCCCc2ccc3c(n2)CCCC3)C1 |
| InChI | InChI=1S/C29H38N2O3/c1-20-18-26(20)24-10-3-4-11-25(24)28(29(32)33)31-16-15-23(19-31)34-17-7-6-9-22-14-13-21-8-2-5-12-27(21)30-22/h3-4,10-11,13-14,20,23,26,28H,2,5-9,12,15-19H2,1H3,(H,32,33)/t20-,23+,26-,28?/m0/s1 |
| InChIKey | HRMUCACCSZDVAN-MKBZYQEJSA-N |
| XLogP | 5.32 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|