C21H22F2N6O3 — CID 147840887
3-[(1,3-dimethyl-2H-imidazol-2-yl)methyl]-3-fluoro-N-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]azetidine-1-carboxamide (PubChem CID 147840887) has the molecular formula C21H22F2N6O3 and a molecular weight of 444.44 g/mol. Its IUPAC name is 3-[(1,3-dimethyl-2H-imidazol-2-yl)methyl]-3-fluoro-N-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]azetidine-1-carboxamide.
| Compound Name | 3-[(1,3-dimethyl-2H-imidazol-2-yl)methyl]-3-fluoro-N-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 147840887 |
| Molecular Formula | C21H22F2N6O3 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 3-[(1,3-dimethyl-2H-imidazol-2-yl)methyl]-3-fluoro-N-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]azetidine-1-carboxamide |
| SMILES | CN1C=CN(C)C1CC1(F)CN(C(=O)Nc2nc(-c3ccc(F)cc3)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H22F2N6O3/c1-26-9-10-27(2)18(26)11-21(23)12-28(13-21)20(30)25-19-17(29(31)32)8-7-16(24-19)14-3-5-15(22)6-4-14/h3-10,18H,11-13H2,1-2H3,(H,24,25,30) |
| InChIKey | HSYHTTXVDAVCOA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|