C21H17F3N6O3 — CID 153394030
N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-3-(1-fluoro-1-pyrimidin-2-ylethyl)azetidine-1-carboxamide (PubChem CID 153394030) has the molecular formula C21H17F3N6O3 and a molecular weight of 458.40 g/mol. Its IUPAC name is N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-3-(1-fluoro-1-pyrimidin-2-ylethyl)azetidine-1-carboxamide.
| Compound Name | N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-3-(1-fluoro-1-pyrimidin-2-ylethyl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 153394030 |
| Molecular Formula | C21H17F3N6O3 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-3-(1-fluoro-1-pyrimidin-2-ylethyl)azetidine-1-carboxamide |
| SMILES | CC(F)(c1ncccn1)C1CN(C(=O)Nc2nc(-c3ccc(F)cc3F)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H17F3N6O3/c1-21(24,19-25-7-2-8-26-19)12-10-29(11-12)20(31)28-18-17(30(32)33)6-5-16(27-18)14-4-3-13(22)9-15(14)23/h2-9,12H,10-11H2,1H3,(H,27,28,31) |
| InChIKey | UQELTUHUOKFKGK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|