C21H18F2N4O4 — CID 158081412
2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-[3-[(5-methyl-1,3-oxazol-2-yl)methyl]azetidin-1-yl]ethanone (PubChem CID 158081412) has the molecular formula C21H18F2N4O4 and a molecular weight of 428.40 g/mol. Its IUPAC name is 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-[3-[(5-methyl-1,3-oxazol-2-yl)methyl]azetidin-1-yl]ethanone.
| Compound Name | 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-[3-[(5-methyl-1,3-oxazol-2-yl)methyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 158081412 |
| Molecular Formula | C21H18F2N4O4 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-[3-[(5-methyl-1,3-oxazol-2-yl)methyl]azetidin-1-yl]ethanone |
| SMILES | Cc1cnc(CC2CN(C(=O)Cc3nc(-c4ccc(F)cc4F)ccc3[N+](=O)[O-])C2)o1 |
| InChI | InChI=1S/C21H18F2N4O4/c1-12-9-24-20(31-12)6-13-10-26(11-13)21(28)8-18-19(27(29)30)5-4-17(25-18)15-3-2-14(22)7-16(15)23/h2-5,7,9,13H,6,8,10-11H2,1H3 |
| InChIKey | JGGLJZJRFRDGLQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|