C18H14F2N4O4 — CID 67777724
6-[4-(2,4-difluorophenyl)-2-(3-methyloxetan-3-yl)-1H-imidazol-5-yl]-3-nitro-1H-pyridin-2-one (PubChem CID 67777724) has the molecular formula C18H14F2N4O4 and a molecular weight of 388.33 g/mol. Its IUPAC name is 6-[4-(2,4-difluorophenyl)-2-(3-methyloxetan-3-yl)-1H-imidazol-5-yl]-3-nitro-1H-pyridin-2-one.
| Compound Name | 6-[4-(2,4-difluorophenyl)-2-(3-methyloxetan-3-yl)-1H-imidazol-5-yl]-3-nitro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 67777724 |
| Molecular Formula | C18H14F2N4O4 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 6-[4-(2,4-difluorophenyl)-2-(3-methyloxetan-3-yl)-1H-imidazol-5-yl]-3-nitro-1H-pyridin-2-one |
| SMILES | CC1(c2nc(-c3ccc(F)cc3F)c(-c3ccc([N+](=O)[O-])c(=O)[nH]3)[nH]2)COC1 |
| InChI | InChI=1S/C18H14F2N4O4/c1-18(7-28-8-18)17-22-14(10-3-2-9(19)6-11(10)20)15(23-17)12-4-5-13(24(26)27)16(25)21-12/h2-6H,7-8H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | CLGUTORVYWWFBN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|