C16H29BN3O3 — CID 147843082
CID 147843082 (PubChem CID 147843082) has the molecular formula C16H29BN3O3 and a molecular weight of 322.24 g/mol.
| Compound Name | CID 147843082 |
|---|---|
| PubChem CID | 147843082 |
| Molecular Formula | C16H29BN3O3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cnn(CCCN2CCOCC2)c1 |
| InChI | InChI=1S/C16H29BN3O3/c1-15(2,21)16(3,4)23-17-14-12-18-20(13-14)7-5-6-19-8-10-22-11-9-19/h12-13,21H,5-11H2,1-4H3 |
| InChIKey | AZPFVCWYPLZXLD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|