C13H23NO3 — CID 14784823
1-[(3S,4S)-3,4-dimethoxypyrrolidin-1-yl]hept-6-en-1-one (PubChem CID 14784823) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-[(3S,4S)-3,4-dimethoxypyrrolidin-1-yl]hept-6-en-1-one.
| Compound Name | 1-[(3S,4S)-3,4-dimethoxypyrrolidin-1-yl]hept-6-en-1-one |
|---|---|
| PubChem CID | 14784823 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 1-[(3S,4S)-3,4-dimethoxypyrrolidin-1-yl]hept-6-en-1-one |
| SMILES | C=CCCCCC(=O)N1C[C@H](OC)[C@@H](OC)C1 |
| InChI | InChI=1S/C13H23NO3/c1-4-5-6-7-8-13(15)14-9-11(16-2)12(10-14)17-3/h4,11-12H,1,5-10H2,2-3H3/t11-,12-/m0/s1 |
| InChIKey | FPUBHDXZEIIZKK-RYUDHWBXSA-N |
| XLogP | 1.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|