C10H17NO3 — CID 54242506
(5S)-3,4-dimethoxy-1-methyl-5-prop-2-enylpyrrolidin-2-one (PubChem CID 54242506) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (5S)-3,4-dimethoxy-1-methyl-5-prop-2-enylpyrrolidin-2-one.
| Compound Name | (5S)-3,4-dimethoxy-1-methyl-5-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 54242506 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (5S)-3,4-dimethoxy-1-methyl-5-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CC[C@H]1C(OC)C(OC)C(=O)N1C |
| InChI | InChI=1S/C10H17NO3/c1-5-6-7-8(13-3)9(14-4)10(12)11(7)2/h5,7-9H,1,6H2,2-4H3/t7-,8?,9?/m0/s1 |
| InChIKey | QQZSTTLBKUDBNE-UEJVZZJDSA-N |
| XLogP | 0.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|