C31H21NO2S — CID 147855025
2-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-1-benzofuran-6-carbaldehyde (PubChem CID 147855025) has the molecular formula C31H21NO2S and a molecular weight of 471.58 g/mol. Its IUPAC name is 2-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-1-benzofuran-6-carbaldehyde.
| Compound Name | 2-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-1-benzofuran-6-carbaldehyde |
|---|---|
| PubChem CID | 147855025 |
| Molecular Formula | C31H21NO2S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-1-benzofuran-6-carbaldehyde |
| SMILES | O=Cc1ccc2cc(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)s3)oc2c1 |
| InChI | InChI=1S/C31H21NO2S/c33-21-22-11-12-24-20-29(34-28(24)19-22)31-18-17-30(35-31)23-13-15-27(16-14-23)32(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-21H |
| InChIKey | HVOIZZKPFDLLOI-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|