C66H48BBrN2O6 — CID 158252401
2-(4-bromophenyl)-1-benzofuran-6-carbaldehyde;[4-(N-phenylanilino)phenyl]boronic acid;2-[4-[4-(N-phenylanilino)phenyl]phenyl]-1-benzofuran-6-carbaldehyde (PubChem CID 158252401) has the molecular formula C66H48BBrN2O6 and a molecular weight of 1055.83 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-benzofuran-6-carbaldehyde;[4-(N-phenylanilino)phenyl]boronic acid;2-[4-[4-(N-phenylanilino)phenyl]phenyl]-1-benzofuran-6-carbaldehyde.
| Compound Name | 2-(4-bromophenyl)-1-benzofuran-6-carbaldehyde;[4-(N-phenylanilino)phenyl]boronic acid;2-[4-[4-(N-phenylanilino)phenyl]phenyl]-1-benzofuran-6-carbaldehyde |
|---|---|
| PubChem CID | 158252401 |
| Molecular Formula | C66H48BBrN2O6 |
| Molecular Weight | 1055.83 g/mol |
| Exact Mass | 1054.28 |
| IUPAC Name | 2-(4-bromophenyl)-1-benzofuran-6-carbaldehyde;[4-(N-phenylanilino)phenyl]boronic acid;2-[4-[4-(N-phenylanilino)phenyl]phenyl]-1-benzofuran-6-carbaldehyde |
| SMILES | O=Cc1ccc2cc(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)oc2c1.O=Cc1ccc2cc(-c3ccc(Br)cc3)oc2c1.OB(O)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H23NO2.C18H16BNO2.C15H9BrO2/c35-23-24-11-12-28-22-33(36-32(28)21-24)27-15-13-25(14-16-27)26-17-19-31(20-18-26)34(29-7-3-1-4-8-29)30-9-5-2-6-10-30;21-19(22)15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;16-13-5-3-11(4-6-13)15-8-12-2-1-10(9-17)7-14(12)18-15/h1-23H;1-14,21-22H;1-9H |
| InChIKey | GGWKEYRQYGWHCV-UHFFFAOYSA-N |
| XLogP | 16.56 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1055.83 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|