C27H24F2N3O+ — CID 147856393
8-(7-cyclopentyl-3-methylquinazolin-3-ium-4-yl)-2,4-difluoro-6,7-dimethyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 147856393) has the molecular formula C27H24F2N3O+ and a molecular weight of 444.51 g/mol. Its IUPAC name is 8-(7-cyclopentyl-3-methylquinazolin-3-ium-4-yl)-2,4-difluoro-6,7-dimethyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-(7-cyclopentyl-3-methylquinazolin-3-ium-4-yl)-2,4-difluoro-6,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 147856393 |
| Molecular Formula | C27H24F2N3O+ |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 8-(7-cyclopentyl-3-methylquinazolin-3-ium-4-yl)-2,4-difluoro-6,7-dimethyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1cc2c(oc3nc(F)cc(F)c32)c(-c2c3ccc(C4CCCC4)cc3nc[n+]2C)c1C |
| InChI | InChI=1S/C27H24F2N3O/c1-14-10-19-24-20(28)12-22(29)31-27(24)33-26(19)23(15(14)2)25-18-9-8-17(16-6-4-5-7-16)11-21(18)30-13-32(25)3/h8-13,16H,4-7H2,1-3H3/q+1 |
| InChIKey | URSXLFNVVYNHFW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|