C9H18N2O — CID 14786275
(Z)-1-(2,2-dimethylhydrazinyl)-5-methylhex-1-en-3-one (PubChem CID 14786275) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is (Z)-1-(2,2-dimethylhydrazinyl)-5-methylhex-1-en-3-one.
| Compound Name | (Z)-1-(2,2-dimethylhydrazinyl)-5-methylhex-1-en-3-one |
|---|---|
| PubChem CID | 14786275 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (Z)-1-(2,2-dimethylhydrazinyl)-5-methylhex-1-en-3-one |
| SMILES | CC(C)CC(=O)/C=C\NN(C)C |
| InChI | InChI=1S/C9H18N2O/c1-8(2)7-9(12)5-6-10-11(3)4/h5-6,8,10H,7H2,1-4H3/b6-5- |
| InChIKey | TXGCVATXKULKPG-WAYWQWQTSA-N |
| XLogP | 1.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|