C27H33F2NO5Si — CID 147879587
6-[(1R)-1-[2-(3,5-difluoro-4-trimethylsilylphenyl)acetyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-6-oxohexanoic acid (PubChem CID 147879587) has the molecular formula C27H33F2NO5Si and a molecular weight of 517.65 g/mol. Its IUPAC name is 6-[(1R)-1-[2-(3,5-difluoro-4-trimethylsilylphenyl)acetyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-6-oxohexanoic acid.
| Compound Name | 6-[(1R)-1-[2-(3,5-difluoro-4-trimethylsilylphenyl)acetyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 147879587 |
| Molecular Formula | C27H33F2NO5Si |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 6-[(1R)-1-[2-(3,5-difluoro-4-trimethylsilylphenyl)acetyl]-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-6-oxohexanoic acid |
| SMILES | COc1ccc2c(c1)CCN(C(=O)CCCCC(=O)O)[C@H]2C(=O)Cc1cc(F)c([Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C27H33F2NO5Si/c1-35-19-9-10-20-18(16-19)11-12-30(24(32)7-5-6-8-25(33)34)26(20)23(31)15-17-13-21(28)27(22(29)14-17)36(2,3)4/h9-10,13-14,16,26H,5-8,11-12,15H2,1-4H3,(H,33,34)/t26-/m1/s1 |
| InChIKey | IAEKKTZMLBIGPL-AREMUKBSSA-N |
| XLogP | 4.40 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|