C27H34F2N2O5Si — CID 160506767
4-[[(1R)-1-[2-(3,5-difluoro-4-trimethylsilylphenyl)acetyl]-6-ethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl]amino]butanoic acid (PubChem CID 160506767) has the molecular formula C27H34F2N2O5Si and a molecular weight of 532.66 g/mol. Its IUPAC name is 4-[[(1R)-1-[2-(3,5-difluoro-4-trimethylsilylphenyl)acetyl]-6-ethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[(1R)-1-[2-(3,5-difluoro-4-trimethylsilylphenyl)acetyl]-6-ethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 160506767 |
| Molecular Formula | C27H34F2N2O5Si |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 4-[[(1R)-1-[2-(3,5-difluoro-4-trimethylsilylphenyl)acetyl]-6-ethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl]amino]butanoic acid |
| SMILES | CCOc1ccc2c(c1)CCN(C(=O)NCCCC(=O)O)[C@H]2C(=O)Cc1cc(F)c([Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C27H34F2N2O5Si/c1-5-36-19-8-9-20-18(16-19)10-12-31(27(35)30-11-6-7-24(33)34)25(20)23(32)15-17-13-21(28)26(22(29)14-17)37(2,3)4/h8-9,13-14,16,25H,5-7,10-12,15H2,1-4H3,(H,30,35)(H,33,34)/t25-/m1/s1 |
| InChIKey | QSMYMYZHWQHVKK-RUZDIDTESA-N |
| XLogP | 4.19 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|