C17H20N4O5S — CID 14788046
ethyl 3-(dimethylcarbamoyl)-6-methyl-4-(3-nitrophenyl)-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 14788046) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is ethyl 3-(dimethylcarbamoyl)-6-methyl-4-(3-nitrophenyl)-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 3-(dimethylcarbamoyl)-6-methyl-4-(3-nitrophenyl)-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 14788046 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | ethyl 3-(dimethylcarbamoyl)-6-methyl-4-(3-nitrophenyl)-2-sulfanylidene-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N(C(=O)N(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H20N4O5S/c1-5-26-15(22)13-10(2)18-16(27)20(17(23)19(3)4)14(13)11-7-6-8-12(9-11)21(24)25/h6-9,14H,5H2,1-4H3,(H,18,27) |
| InChIKey | XXBABGQIHWRAEY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|