C27H23ClF3NO5 — CID 147915279
4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-2-oxopentyl]benzoic acid (PubChem CID 147915279) has the molecular formula C27H23ClF3NO5 and a molecular weight of 533.93 g/mol. Its IUPAC name is 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-2-oxopentyl]benzoic acid.
| Compound Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-2-oxopentyl]benzoic acid |
|---|---|
| PubChem CID | 147915279 |
| Molecular Formula | C27H23ClF3NO5 |
| Molecular Weight | 533.93 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 4-[3-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-4-cyclopropyl-2-oxopentyl]benzoic acid |
| SMILES | CC(C1CC1)C(C(=O)Cc1ccc(C(=O)O)cc1)c1ccc(-c2c(OC(F)F)ccc(Cl)c2F)c[n+]1[O-] |
| InChI | InChI=1S/C27H23ClF3NO5/c1-14(16-6-7-16)23(21(33)12-15-2-4-17(5-3-15)26(34)35)20-10-8-18(13-32(20)36)24-22(37-27(30)31)11-9-19(28)25(24)29/h2-5,8-11,13-14,16,23,27H,6-7,12H2,1H3,(H,34,35) |
| InChIKey | IGYBXXCXPKRVDA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.93 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|