C6H8ClF3N2 — CID 147925672
N-[(Z)-3-chloroprop-1-enyl]-2,2,2-trifluoro-N'-methylethanimidamide (PubChem CID 147925672) has the molecular formula C6H8ClF3N2 and a molecular weight of 200.59 g/mol. Its IUPAC name is N-[(Z)-3-chloroprop-1-enyl]-2,2,2-trifluoro-N'-methylethanimidamide.
| Compound Name | N-[(Z)-3-chloroprop-1-enyl]-2,2,2-trifluoro-N'-methylethanimidamide |
|---|---|
| PubChem CID | 147925672 |
| Molecular Formula | C6H8ClF3N2 |
| Molecular Weight | 200.59 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | N-[(Z)-3-chloroprop-1-enyl]-2,2,2-trifluoro-N'-methylethanimidamide |
| SMILES | C/N=C(\N/C=C\CCl)C(F)(F)F |
| InChI | InChI=1S/C6H8ClF3N2/c1-11-5(6(8,9)10)12-4-2-3-7/h2,4H,3H2,1H3,(H,11,12)/b4-2- |
| InChIKey | IIWKGXWOXKOBFT-RQOWECAXSA-N |
| XLogP | 1.92 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.59 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|