C15H13ClN2OS — CID 1479305
(S)-(5-chloro-1-methyl-3-phenylpyrazol-4-yl)-thiophen-2-ylmethanol (PubChem CID 1479305) has the molecular formula C15H13ClN2OS and a molecular weight of 304.80 g/mol. Its IUPAC name is (S)-(5-chloro-1-methyl-3-phenylpyrazol-4-yl)-thiophen-2-ylmethanol.
| Compound Name | (S)-(5-chloro-1-methyl-3-phenylpyrazol-4-yl)-thiophen-2-ylmethanol |
|---|---|
| PubChem CID | 1479305 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (S)-(5-chloro-1-methyl-3-phenylpyrazol-4-yl)-thiophen-2-ylmethanol |
| SMILES | Cn1nc(-c2ccccc2)c([C@H](O)c2cccs2)c1Cl |
| InChI | InChI=1S/C15H13ClN2OS/c1-18-15(16)12(14(19)11-8-5-9-20-11)13(17-18)10-6-3-2-4-7-10/h2-9,14,19H,1H3/t14-/m1/s1 |
| InChIKey | IXENXWCHAVNGCN-CQSZACIVSA-N |
| XLogP | 3.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |