C27H31N7O2 — CID 147937112
2-[4-[[4-[2-(3-amino-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl)acetyl]triazol-1-yl]methyl]phenyl]-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-1-one (PubChem CID 147937112) has the molecular formula C27H31N7O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 2-[4-[[4-[2-(3-amino-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl)acetyl]triazol-1-yl]methyl]phenyl]-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-1-one.
| Compound Name | 2-[4-[[4-[2-(3-amino-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl)acetyl]triazol-1-yl]methyl]phenyl]-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 147937112 |
| Molecular Formula | C27H31N7O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 2-[4-[[4-[2-(3-amino-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl)acetyl]triazol-1-yl]methyl]phenyl]-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-1-one |
| SMILES | Nc1cc2c(cn1)C(CC(=O)c1cn(Cc3ccc(N4CCN5CCCCC5C4=O)cc3)nn1)CC2 |
| InChI | InChI=1S/C27H31N7O2/c28-26-14-20-7-6-19(22(20)15-29-26)13-25(35)23-17-33(31-30-23)16-18-4-8-21(9-5-18)34-12-11-32-10-2-1-3-24(32)27(34)36/h4-5,8-9,14-15,17,19,24H,1-3,6-7,10-13,16H2,(H2,28,29) |
| InChIKey | IKZZCYOYXZSPIX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |