C18H20N5NaO3 — CID 140939200
sodium 1-[[3-(1-oxo-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-2-yl)phenyl]methyl]triazole-4-carboxylate (PubChem CID 140939200) has the molecular formula C18H20N5NaO3 and a molecular weight of 377.38 g/mol. Its IUPAC name is sodium 1-[[3-(1-oxo-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-2-yl)phenyl]methyl]triazole-4-carboxylate.
| Compound Name | sodium 1-[[3-(1-oxo-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-2-yl)phenyl]methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 140939200 |
| Molecular Formula | C18H20N5NaO3 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | sodium 1-[[3-(1-oxo-4,6,7,8,9,9a-hexahydro-3H-pyrido[1,2-a]pyrazin-2-yl)phenyl]methyl]triazole-4-carboxylate |
| SMILES | O=C([O-])c1cn(Cc2cccc(N3CCN4CCCCC4C3=O)c2)nn1.[Na+] |
| InChI | InChI=1S/C18H21N5O3.Na/c24-17-16-6-1-2-7-21(16)8-9-23(17)14-5-3-4-13(10-14)11-22-12-15(18(25)26)19-20-22;/h3-5,10,12,16H,1-2,6-9,11H2,(H,25,26);/q;+1/p-1 |
| InChIKey | VRHPWKPXRANZNS-UHFFFAOYSA-M |
| XLogP | -3.11 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |