C20H18ClN5O2 — CID 25453569
4-[1-[(3-chlorophenyl)methyl]triazole-4-carbonyl]-1-phenylpiperazin-2-one (PubChem CID 25453569) has the molecular formula C20H18ClN5O2 and a molecular weight of 395.85 g/mol. Its IUPAC name is 4-[1-[(3-chlorophenyl)methyl]triazole-4-carbonyl]-1-phenylpiperazin-2-one.
| Compound Name | 4-[1-[(3-chlorophenyl)methyl]triazole-4-carbonyl]-1-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 25453569 |
| Molecular Formula | C20H18ClN5O2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 4-[1-[(3-chlorophenyl)methyl]triazole-4-carbonyl]-1-phenylpiperazin-2-one |
| SMILES | O=C(c1cn(Cc2cccc(Cl)c2)nn1)N1CCN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C20H18ClN5O2/c21-16-6-4-5-15(11-16)12-25-13-18(22-23-25)20(28)24-9-10-26(19(27)14-24)17-7-2-1-3-8-17/h1-8,11,13H,9-10,12,14H2 |
| InChIKey | PUQASJBXBDRPEP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |