C18H21F2N5O — CID 56885530
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]methanone (PubChem CID 56885530) has the molecular formula C18H21F2N5O and a molecular weight of 361.40 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]methanone |
|---|---|
| PubChem CID | 56885530 |
| Molecular Formula | C18H21F2N5O |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]methanone |
| SMILES | O=C(c1cn(Cc2c(F)cccc2F)nn1)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C18H21F2N5O/c19-15-5-3-6-16(20)14(15)11-25-12-17(21-22-25)18(26)24-9-8-23-7-2-1-4-13(23)10-24/h3,5-6,12-13H,1-2,4,7-11H2 |
| InChIKey | FRCRDXFWZCSIIY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |