C14H17NOS — CID 147938711
(2E,4E)-1-piperidin-1-yl-5-thiophen-3-ylpenta-2,4-dien-1-one (PubChem CID 147938711) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is (2E,4E)-1-piperidin-1-yl-5-thiophen-3-ylpenta-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-piperidin-1-yl-5-thiophen-3-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 147938711 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (2E,4E)-1-piperidin-1-yl-5-thiophen-3-ylpenta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccsc1)N1CCCCC1 |
| InChI | InChI=1S/C14H17NOS/c16-14(15-9-4-1-5-10-15)7-3-2-6-13-8-11-17-12-13/h2-3,6-8,11-12H,1,4-5,9-10H2/b6-2+,7-3+ |
| InChIKey | ILHRSZAOGZJHDC-YPCIICBESA-N |
| XLogP | 3.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|