C16H22F3NOS — CID 23236966
(Z)-N,N-dibutyl-3-thiophen-3-yl-2-(trifluoromethyl)prop-2-enamide (PubChem CID 23236966) has the molecular formula C16H22F3NOS and a molecular weight of 333.42 g/mol. Its IUPAC name is (Z)-N,N-dibutyl-3-thiophen-3-yl-2-(trifluoromethyl)prop-2-enamide.
| Compound Name | (Z)-N,N-dibutyl-3-thiophen-3-yl-2-(trifluoromethyl)prop-2-enamide |
|---|---|
| PubChem CID | 23236966 |
| Molecular Formula | C16H22F3NOS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (Z)-N,N-dibutyl-3-thiophen-3-yl-2-(trifluoromethyl)prop-2-enamide |
| SMILES | CCCCN(CCCC)C(=O)/C(=C/c1ccsc1)C(F)(F)F |
| InChI | InChI=1S/C16H22F3NOS/c1-3-5-8-20(9-6-4-2)15(21)14(16(17,18)19)11-13-7-10-22-12-13/h7,10-12H,3-6,8-9H2,1-2H3/b14-11- |
| InChIKey | RRFICSYPKUHPMR-KAMYIIQDSA-N |
| XLogP | 5.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|