C21H28N2O3S — CID 147938874
N-[(3-methoxythiophen-2-yl)methyl]-2-[(5R,9S)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine (PubChem CID 147938874) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is N-[(3-methoxythiophen-2-yl)methyl]-2-[(5R,9S)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine.
| Compound Name | N-[(3-methoxythiophen-2-yl)methyl]-2-[(5R,9S)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine |
|---|---|
| PubChem CID | 147938874 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[(3-methoxythiophen-2-yl)methyl]-2-[(5R,9S)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine |
| SMILES | COc1ccsc1CNCC[C@]1(c2ccccn2)CCO[C@@]2(CCOC2)C1 |
| InChI | InChI=1S/C21H28N2O3S/c1-24-17-5-13-27-18(17)14-22-10-6-20(19-4-2-3-9-23-19)7-12-26-21(15-20)8-11-25-16-21/h2-5,9,13,22H,6-8,10-12,14-16H2,1H3/t20-,21-/m0/s1 |
| InChIKey | ILILGGPBJCSIFA-SFTDATJTSA-N |
| XLogP | 3.54 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|