C19H18ClN3S — CID 1479455
N-benzyl-6-[(4-chlorophenyl)sulfanylmethyl]-2-methylpyrimidin-4-amine (PubChem CID 1479455) has the molecular formula C19H18ClN3S and a molecular weight of 355.89 g/mol. Its IUPAC name is N-benzyl-6-[(4-chlorophenyl)sulfanylmethyl]-2-methylpyrimidin-4-amine.
| Compound Name | N-benzyl-6-[(4-chlorophenyl)sulfanylmethyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 1479455 |
| Molecular Formula | C19H18ClN3S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-benzyl-6-[(4-chlorophenyl)sulfanylmethyl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(CSc2ccc(Cl)cc2)cc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C19H18ClN3S/c1-14-22-17(13-24-18-9-7-16(20)8-10-18)11-19(23-14)21-12-15-5-3-2-4-6-15/h2-11H,12-13H2,1H3,(H,21,22,23) |
| InChIKey | JFXONOUWZJGQNU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |