C12H17N3O2S — CID 14796165
N-[cyano(propoxy)methyl]-4-ethyl-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 14796165) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[cyano(propoxy)methyl]-4-ethyl-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[cyano(propoxy)methyl]-4-ethyl-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 14796165 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[cyano(propoxy)methyl]-4-ethyl-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCOC(C#N)NC(=O)c1sc(C)nc1CC |
| InChI | InChI=1S/C12H17N3O2S/c1-4-6-17-10(7-13)15-12(16)11-9(5-2)14-8(3)18-11/h10H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | FKPVBULSUCPKKL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|