C24H33N3O3 — CID 147964608
8-(cyclohexylmethoxy)-2-ethenyl-N-[(2R)-3-ethyl-1-hydroxypent-4-en-2-yl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 147964608) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 8-(cyclohexylmethoxy)-2-ethenyl-N-[(2R)-3-ethyl-1-hydroxypent-4-en-2-yl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 8-(cyclohexylmethoxy)-2-ethenyl-N-[(2R)-3-ethyl-1-hydroxypent-4-en-2-yl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 147964608 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 8-(cyclohexylmethoxy)-2-ethenyl-N-[(2R)-3-ethyl-1-hydroxypent-4-en-2-yl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | C=Cc1nc2c(OCC3CCCCC3)cccn2c1C(=O)N[C@@H](CO)C(C=C)CC |
| InChI | InChI=1S/C24H33N3O3/c1-4-18(5-2)20(15-28)26-24(29)22-19(6-3)25-23-21(13-10-14-27(22)23)30-16-17-11-8-7-9-12-17/h4,6,10,13-14,17-18,20,28H,1,3,5,7-9,11-12,15-16H2,2H3,(H,26,29)/t18?,20-/m0/s1 |
| InChIKey | IQDKYASSRXQJLC-IJHRGXPZSA-N |
| XLogP | 4.24 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|