C21H31N3O5 — CID 90115741
8-(cyclohexylmethoxy)-2-ethyl-N-[(2R)-1-hydroxypropan-2-yl]imidazo[1,2-a]pyridine-3-carboxamide;formic acid (PubChem CID 90115741) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is 8-(cyclohexylmethoxy)-2-ethyl-N-[(2R)-1-hydroxypropan-2-yl]imidazo[1,2-a]pyridine-3-carboxamide;formic acid.
| Compound Name | 8-(cyclohexylmethoxy)-2-ethyl-N-[(2R)-1-hydroxypropan-2-yl]imidazo[1,2-a]pyridine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 90115741 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 8-(cyclohexylmethoxy)-2-ethyl-N-[(2R)-1-hydroxypropan-2-yl]imidazo[1,2-a]pyridine-3-carboxamide;formic acid |
| SMILES | CCc1nc2c(OCC3CCCCC3)cccn2c1C(=O)N[C@H](C)CO.O=CO |
| InChI | InChI=1S/C20H29N3O3.CH2O2/c1-3-16-18(20(25)21-14(2)12-24)23-11-7-10-17(19(23)22-16)26-13-15-8-5-4-6-9-15;2-1-3/h7,10-11,14-15,24H,3-6,8-9,12-13H2,1-2H3,(H,21,25);1H,(H,2,3)/t14-;/m1./s1 |
| InChIKey | CLOBSYGJAOERAW-PFEQFJNWSA-N |
| XLogP | 2.67 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|