C7H5Cl2NO4S — CID 1479657
2-[(3,5-dichloro-2-pyridinyl)sulfonyl]acetic acid (PubChem CID 1479657) has the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-pyridinyl)sulfonyl]acetic acid.
| Compound Name | 2-[(3,5-dichloro-2-pyridinyl)sulfonyl]acetic acid |
|---|---|
| PubChem CID | 1479657 |
| Molecular Formula | C7H5Cl2NO4S |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 268.93 |
| IUPAC Name | 2-[(3,5-dichloro-2-pyridinyl)sulfonyl]acetic acid |
| SMILES | O=C(O)CS(=O)(=O)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl2NO4S/c8-4-1-5(9)7(10-2-4)15(13,14)3-6(11)12/h1-2H,3H2,(H,11,12) |
| InChIKey | KVNKMVWBPSKPEO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |