C9H7ClF3NO2S — CID 24701173
3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid (PubChem CID 24701173) has the molecular formula C9H7ClF3NO2S and a molecular weight of 285.67 g/mol. Its IUPAC name is 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid.
| Compound Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 24701173 |
| Molecular Formula | C9H7ClF3NO2S |
| Molecular Weight | 285.67 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]propanoic acid |
| SMILES | O=C(O)CCSc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H7ClF3NO2S/c10-6-3-5(9(11,12)13)4-14-8(6)17-2-1-7(15)16/h3-4H,1-2H2,(H,15,16) |
| InChIKey | FRWPUNSFSHFMPU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |