C10H12Cl2N2O2 — CID 1479848
4,5-dichloro-2-(3,3-dimethyl-2-oxobutyl)pyridazin-3-one (PubChem CID 1479848) has the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 4,5-dichloro-2-(3,3-dimethyl-2-oxobutyl)pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-(3,3-dimethyl-2-oxobutyl)pyridazin-3-one |
|---|---|
| PubChem CID | 1479848 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 4,5-dichloro-2-(3,3-dimethyl-2-oxobutyl)pyridazin-3-one |
| SMILES | CC(C)(C)C(=O)Cn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H12Cl2N2O2/c1-10(2,3)7(15)5-14-9(16)8(12)6(11)4-13-14/h4H,5H2,1-3H3 |
| InChIKey | WKYFPTRSCBXGPY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |