C10H14Cl2N2O2 — CID 102974987
4,5-dichloro-2-(3-methoxy-3-methylbutyl)pyridazin-3-one (PubChem CID 102974987) has the molecular formula C10H14Cl2N2O2 and a molecular weight of 265.14 g/mol. Its IUPAC name is 4,5-dichloro-2-(3-methoxy-3-methylbutyl)pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-(3-methoxy-3-methylbutyl)pyridazin-3-one |
|---|---|
| PubChem CID | 102974987 |
| Molecular Formula | C10H14Cl2N2O2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 4,5-dichloro-2-(3-methoxy-3-methylbutyl)pyridazin-3-one |
| SMILES | COC(C)(C)CCn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C10H14Cl2N2O2/c1-10(2,16-3)4-5-14-9(15)8(12)7(11)6-13-14/h6H,4-5H2,1-3H3 |
| InChIKey | KZNHQGOFRXPTME-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |