C12H7Cl3N2O3 — CID 1474461
(4,5-dichloro-6-oxopyridazin-1-yl)methyl 2-chlorobenzoate (PubChem CID 1474461) has the molecular formula C12H7Cl3N2O3 and a molecular weight of 333.56 g/mol. Its IUPAC name is (4,5-dichloro-6-oxopyridazin-1-yl)methyl 2-chlorobenzoate.
| Compound Name | (4,5-dichloro-6-oxopyridazin-1-yl)methyl 2-chlorobenzoate |
|---|---|
| PubChem CID | 1474461 |
| Molecular Formula | C12H7Cl3N2O3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | (4,5-dichloro-6-oxopyridazin-1-yl)methyl 2-chlorobenzoate |
| SMILES | O=C(OCn1ncc(Cl)c(Cl)c1=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H7Cl3N2O3/c13-8-4-2-1-3-7(8)12(19)20-6-17-11(18)10(15)9(14)5-16-17/h1-5H,6H2 |
| InChIKey | XUUFIOHTEHAJQL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |