C19H14Cl2N2O3 — CID 24572321
(2-methylphenyl)methyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate (PubChem CID 24572321) has the molecular formula C19H14Cl2N2O3 and a molecular weight of 389.24 g/mol. Its IUPAC name is (2-methylphenyl)methyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate.
| Compound Name | (2-methylphenyl)methyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate |
|---|---|
| PubChem CID | 24572321 |
| Molecular Formula | C19H14Cl2N2O3 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | (2-methylphenyl)methyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate |
| SMILES | Cc1ccccc1COC(=O)c1ccccc1-n1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C19H14Cl2N2O3/c1-12-6-2-3-7-13(12)11-26-19(25)14-8-4-5-9-16(14)23-18(24)17(21)15(20)10-22-23/h2-10H,11H2,1H3 |
| InChIKey | QKEXSNVCOOCJCL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |