C19H19Cl2N3O4 — CID 18158067
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate (PubChem CID 18158067) has the molecular formula C19H19Cl2N3O4 and a molecular weight of 424.28 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate |
|---|---|
| PubChem CID | 18158067 |
| Molecular Formula | C19H19Cl2N3O4 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)c1ccccc1-n1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C19H19Cl2N3O4/c1-4-23(10-12(2)3)16(25)11-28-19(27)13-7-5-6-8-15(13)24-18(26)17(21)14(20)9-22-24/h5-9H,2,4,10-11H2,1,3H3 |
| InChIKey | WXQXEKKJWHENAA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|