C20H14Cl2N2O3 — CID 24522928
[(E)-3-phenylprop-2-enyl] 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate (PubChem CID 24522928) has the molecular formula C20H14Cl2N2O3 and a molecular weight of 401.25 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate.
| Compound Name | [(E)-3-phenylprop-2-enyl] 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate |
|---|---|
| PubChem CID | 24522928 |
| Molecular Formula | C20H14Cl2N2O3 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate |
| SMILES | O=C(OC/C=C/c1ccccc1)c1ccccc1-n1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C20H14Cl2N2O3/c21-16-13-23-24(19(25)18(16)22)17-11-5-4-10-15(17)20(26)27-12-6-9-14-7-2-1-3-8-14/h1-11,13H,12H2/b9-6+ |
| InChIKey | MCSVMMMGAWLIJX-RMKNXTFCSA-N |
| XLogP | 4.41 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |