C15H10Cl4N2O3 — CID 18286795
(2,2-dichlorocyclopropyl)methyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate (PubChem CID 18286795) has the molecular formula C15H10Cl4N2O3 and a molecular weight of 408.07 g/mol. Its IUPAC name is (2,2-dichlorocyclopropyl)methyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate.
| Compound Name | (2,2-dichlorocyclopropyl)methyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate |
|---|---|
| PubChem CID | 18286795 |
| Molecular Formula | C15H10Cl4N2O3 |
| Molecular Weight | 408.07 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | (2,2-dichlorocyclopropyl)methyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate |
| SMILES | O=C(OCC1CC1(Cl)Cl)c1ccccc1-n1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C15H10Cl4N2O3/c16-10-6-20-21(13(22)12(10)17)11-4-2-1-3-9(11)14(23)24-7-8-5-15(8,18)19/h1-4,6,8H,5,7H2 |
| InChIKey | PBEXOGSACYZANI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.07 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|