C17H18ClN3O3 — CID 133439078
methyl 2-[5-chloro-4-[methyl(2-methylprop-2-enyl)amino]-6-oxopyridazin-1-yl]benzoate (PubChem CID 133439078) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is methyl 2-[5-chloro-4-[methyl(2-methylprop-2-enyl)amino]-6-oxopyridazin-1-yl]benzoate.
| Compound Name | methyl 2-[5-chloro-4-[methyl(2-methylprop-2-enyl)amino]-6-oxopyridazin-1-yl]benzoate |
|---|---|
| PubChem CID | 133439078 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | methyl 2-[5-chloro-4-[methyl(2-methylprop-2-enyl)amino]-6-oxopyridazin-1-yl]benzoate |
| SMILES | C=C(C)CN(C)c1cnn(-c2ccccc2C(=O)OC)c(=O)c1Cl |
| InChI | InChI=1S/C17H18ClN3O3/c1-11(2)10-20(3)14-9-19-21(16(22)15(14)18)13-8-6-5-7-12(13)17(23)24-4/h5-9H,1,10H2,2-4H3 |
| InChIKey | YTOPKQYSXGYEJB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|