C22H18ClN5O3 — CID 36597870
methyl 2-[5-chloro-6-oxo-4-[(1-phenylpyrazol-4-yl)methylamino]pyridazin-1-yl]benzoate (PubChem CID 36597870) has the molecular formula C22H18ClN5O3 and a molecular weight of 435.87 g/mol. Its IUPAC name is methyl 2-[5-chloro-6-oxo-4-[(1-phenylpyrazol-4-yl)methylamino]pyridazin-1-yl]benzoate.
| Compound Name | methyl 2-[5-chloro-6-oxo-4-[(1-phenylpyrazol-4-yl)methylamino]pyridazin-1-yl]benzoate |
|---|---|
| PubChem CID | 36597870 |
| Molecular Formula | C22H18ClN5O3 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | methyl 2-[5-chloro-6-oxo-4-[(1-phenylpyrazol-4-yl)methylamino]pyridazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1ncc(NCc2cnn(-c3ccccc3)c2)c(Cl)c1=O |
| InChI | InChI=1S/C22H18ClN5O3/c1-31-22(30)17-9-5-6-10-19(17)28-21(29)20(23)18(13-26-28)24-11-15-12-25-27(14-15)16-7-3-2-4-8-16/h2-10,12-14,24H,11H2,1H3 |
| InChIKey | JJJPUQLAVJCQCW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |