C20H17ClF3N5O3 — CID 32802441
methyl 2-[5-chloro-6-oxo-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]pyridazin-1-yl]benzoate (PubChem CID 32802441) has the molecular formula C20H17ClF3N5O3 and a molecular weight of 467.84 g/mol. Its IUPAC name is methyl 2-[5-chloro-6-oxo-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]pyridazin-1-yl]benzoate.
| Compound Name | methyl 2-[5-chloro-6-oxo-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]pyridazin-1-yl]benzoate |
|---|---|
| PubChem CID | 32802441 |
| Molecular Formula | C20H17ClF3N5O3 |
| Molecular Weight | 467.84 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | methyl 2-[5-chloro-6-oxo-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]pyridazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1ncc(NCCNc2ccc(C(F)(F)F)cn2)c(Cl)c1=O |
| InChI | InChI=1S/C20H17ClF3N5O3/c1-32-19(31)13-4-2-3-5-15(13)29-18(30)17(21)14(11-28-29)25-8-9-26-16-7-6-12(10-27-16)20(22,23)24/h2-7,10-11,25H,8-9H2,1H3,(H,26,27) |
| InChIKey | KGCSQFUIJRQELS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.84 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|