C22H17ClN4O3 — CID 133277487
methyl 2-[5-chloro-6-oxo-4-(quinolin-8-ylmethylamino)pyridazin-1-yl]benzoate (PubChem CID 133277487) has the molecular formula C22H17ClN4O3 and a molecular weight of 420.86 g/mol. Its IUPAC name is methyl 2-[5-chloro-6-oxo-4-(quinolin-8-ylmethylamino)pyridazin-1-yl]benzoate.
| Compound Name | methyl 2-[5-chloro-6-oxo-4-(quinolin-8-ylmethylamino)pyridazin-1-yl]benzoate |
|---|---|
| PubChem CID | 133277487 |
| Molecular Formula | C22H17ClN4O3 |
| Molecular Weight | 420.86 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | methyl 2-[5-chloro-6-oxo-4-(quinolin-8-ylmethylamino)pyridazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-n1ncc(NCc2cccc3cccnc23)c(Cl)c1=O |
| InChI | InChI=1S/C22H17ClN4O3/c1-30-22(29)16-9-2-3-10-18(16)27-21(28)19(23)17(13-26-27)25-12-15-7-4-6-14-8-5-11-24-20(14)15/h2-11,13,25H,12H2,1H3 |
| InChIKey | OVVNPZGTLASSMG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |