C12H9Cl3N2O2 — CID 78761108
4,5-dichloro-2-[2-(2-chlorophenoxy)ethyl]pyridazin-3-one (PubChem CID 78761108) has the molecular formula C12H9Cl3N2O2 and a molecular weight of 319.57 g/mol. Its IUPAC name is 4,5-dichloro-2-[2-(2-chlorophenoxy)ethyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[2-(2-chlorophenoxy)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 78761108 |
| Molecular Formula | C12H9Cl3N2O2 |
| Molecular Weight | 319.57 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 4,5-dichloro-2-[2-(2-chlorophenoxy)ethyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CCOc1ccccc1Cl |
| InChI | InChI=1S/C12H9Cl3N2O2/c13-8-3-1-2-4-10(8)19-6-5-17-12(18)11(15)9(14)7-16-17/h1-4,7H,5-6H2 |
| InChIKey | RBAUYEAQCFLGJL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |